| Name | 4'-Chloroacetoacetanilide |
| Synonyms | AAPCA 4'-Chloroacetoacetan LABOTEST-BB LT01274571 4'-CHLOROACETACETANILIDE ACETOACET-P-CHLORANILIDE ACETOACET-P-CHLOROAMILIDE ACETOACET-P-CHLOROANILIDE Acetoacet-d-Chloroanilide 4'-CHLOROACETOACETANILIDE 4'-Chloroacetoacetanilide Acetoacet-2-CarboxyAnilide AcetoAcet-P-ChlorolAnilide acetoacetyl-4-chloroanilide Acetoacetic-p-chloroanilide N-(4-chlorophenyl)-3-oxobutanamide |
| CAS | 101-92-8 |
| EINECS | 202-989-6 |
| InChI | InChI=1/C10H10ClNO2/c1-7(13)6-10(14)12-9-4-2-8(11)3-5-9/h2-5H,6H2,1H3,(H,12,14) |
| Molecular Formula | C10H10ClNO2 |
| Molar Mass | 211.64 |
| Density | 1.44 g/cm3 (20℃) |
| Melting Point | 131-134 °C (lit.) |
| Boling Point | 303°C (rough estimate) |
| Flash Point | 350°F(COC) |
| Solubility | acetone: soluble25mg/mL, clear, colorless to light yellow |
| Vapor Presure | 1.26E-06mmHg at 25°C |
| Vapor Density | 7.31 |
| Appearance | Crystalline powder |
| Color | Off-white to beige |
| pKa | 11.00±0.46(Predicted) |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | 1.5388 (estimate) |
| MDL | MFCD00000613 |
| Safety Description | 24/25 - Avoid contact with skin and eyes. |
| WGK Germany | 1 |
| RTECS | AK4375000 |
| HS Code | 29242990 |
| Toxicity | ipr-mus LDLo 500 mg/kg CBCCT* 4,225,52 |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| application | 4 '-chloroacetanilide can be used in the competitive binding test of recombinant androgen receptor as an analysis of natural, synthetic and environmental chemicals. |
| use | is mainly used to synthesize coupling components of c. I pigment orange 44 and other varieties. |
| category | toxic substances |
| toxicity classification | poisoning |
| acute toxicity | abdominal cavity-mouse LDL0: 500 mg/kg |
| flammability hazard characteristics | flammability; heating decomposition releases toxic nitrogen oxides, chloride and cyanide fumes |
| storage and transportation characteristics | warehouse ventilation and low temperature drying |
| fire extinguishing agent | dry powder, foam, sand, water |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |